قناة علوم عظيمة على اليوتيوب

الموسوعة الحرة

أرباجميعوفن بلاكاربيل

هذا المقال يخضع للمعالجة الالية من طرف كشًاف، إذا كانت لديك أي ملاحظات عليه لا تتردد في مراسلتنا.

= | elimination_half-life = | excretion = | CASNo_Ref =  Y | CAS_number = 84735ت-30-4 | ATC_prefix = | ATC_suffix = | ATC_supplemental...
{{معلومات دواء | English = Arbaclofen placarbil | verifiedrevid = | IUPAC_name = (3R)-ت-(ج-chlorophenyl)-ج-[[[(1S)-ب-methyl-أ-[(ب-methylpropanoyl)oxy]propoxy]carbonyl]amino]butanoic acid | image = Arbaclofen placarbil.svg | width = 260
| tradename = | Drugs.com = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CASNo_Ref =  ☑Y | CAS_number = 84735ت-30-4 | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 96025544 | DrugBank_Ref =  ☑Y | DrugBank = | ChemSpiderID_Ref =  ☑Y | ChemSpiderID = | UNII_Ref =  ☑Y | UNII = | KEGG_Ref =  ☑Y | KEGG = D08861 | ChEMBL_Ref =  Yes Check Circle.svg | ChEMBL =
| C=19 | H=26 | Cl=1 | N=1 | O=6 | molecular_weight = 399.86 g/mol | smiles = C1C=C(C=CC=1[C@H](CNC(=O)O[C@H](OC(=O)C(C)C)C(C)C)CC(O)=O)Cl | InChI=1S/C19H26ClNO6/cأ-11(2)17(24)2خ-18(12(3)4)2د-19(25)2أ-ر-14(ز-16(22)23)ص-ح-د-15(20)ذ-خ-13/hح-8,1أ-12,14,18H,ز-10H2,أ-4H3,(H,21,25)(H,22,23)/tط-,18?/m1/s1 | InChIKey = | StdInChI_Ref =  ☑Y | StdInChI = | StdInChIKey_Ref =  ☑Y | StdInChIKey = }} أرباجميعوفن بلاكاربيل (بالإنجليزية: Arbaclofen placarbil)‏ (المعروف أيضاً بـ XP19986) هو طليعة دواء غير مألوفة لباجميعوفن المُيمّن R-baclofen. يمتلك أرباجميعوفن بلاكاربيل ملف حركية دوائية ملائم أكثر عبر الباجميعوفن ، مع تأرجحات أقل في مستويات الدواء في البلازما. تم تطويره كعلاج محتمل لسقمى القلس المعدي المريئي و فرط التوتر التشنجي المُسبب بالتصلب اللويحي ، على جميع حال، في شهر أيار عام 2013 فإذا شركة XenoPort أعربت عن انتهاء التطوير بسبب النتائج غير الناجحة في الطور الثالث عبر التجارب السريرية.
المصدر
  • -موسوعة العلوم العربية
مراجع
  1. مُعرِّف "بَب كِيم" (PubChem CID): https://pubchem.ncbi.nlm.nih.gov/compound/11281011 — تاريخ الاطلاع: 14 أكتوبر 2016 — العنوان : Arbaclofen placarbil — الرخصة: محتوى حر
  2. ^ "JXTAALBWJQJLGN-KSSFIOAISA-N"%5bInChIKey%5d "معلومات عن أرباجميعوفن بلاكاربيل على مسقط ncbi.nlm.nih.gov". ncbi.nlm.nih.gov.
  3. ^ "معلومات عن أرباجميعوفن بلاكاربيل على مسقط drugbank.ca". drugbank.ca. مؤرشف عبر الأصل في 25 نوفمبر 2015.
  4. ^ "معلومات عن أرباجميعوفن بلاكاربيل على مسقط comptox.epa.gov". comptox.epa.gov. مؤرشف عبر الأصل فيعشرة مايو 2019.

مجلوبة عبر «https://ar.wikipedia.org/w/index.php?title=أرباجميعوفن_بلاكاربيل&oldid=53851644»
السابق
أرباكلوفن بلاكاربيل
التالي
أربوتين

0 تعليقات

أضف تعليقا

اترك تعليقاً